C19H33ClN4O3 — CID 111653420
1-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-methylguanidine (PubChem CID 111653420) has the molecular formula C19H33ClN4O3 and a molecular weight of 400.95 g/mol. Its IUPAC name is 1-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-methylguanidine.
| Compound Name | 1-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111653420 |
| Molecular Formula | C19H33ClN4O3 |
| Molecular Weight | 400.95 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 1-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-methylguanidine |
| SMILES | CCOc1c(Cl)cc(CN/C(=N/C)NCCN(C)CCCOC)cc1OC |
| InChI | InChI=1S/C19H33ClN4O3/c1-6-27-18-16(20)12-15(13-17(18)26-5)14-23-19(21-2)22-8-10-24(3)9-7-11-25-4/h12-13H,6-11,14H2,1-5H3,(H2,21,22,23) |
| InChIKey | VEXITZSESXVGQW-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.95 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|