C23H31N5OS — CID 111656096
1-ethyl-2-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]-3-[2-(naphthalen-1-ylmethylsulfanyl)ethyl]guanidine (PubChem CID 111656096) has the molecular formula C23H31N5OS and a molecular weight of 425.60 g/mol. Its IUPAC name is 1-ethyl-2-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]-3-[2-(naphthalen-1-ylmethylsulfanyl)ethyl]guanidine.
| Compound Name | 1-ethyl-2-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]-3-[2-(naphthalen-1-ylmethylsulfanyl)ethyl]guanidine |
|---|---|
| PubChem CID | 111656096 |
| Molecular Formula | C23H31N5OS |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 1-ethyl-2-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]-3-[2-(naphthalen-1-ylmethylsulfanyl)ethyl]guanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1cnn(C)c1)NCCSCc1cccc2ccccc12 |
| InChI | InChI=1S/C23H31N5OS/c1-4-24-22(26-17-23(2,29)20-14-27-28(3)15-20)25-12-13-30-16-19-10-7-9-18-8-5-6-11-21(18)19/h5-11,14-15,29H,4,12-13,16-17H2,1-3H3,(H2,24,25,26) |
| InChIKey | WWETXLKBRNGERB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|