C18H27IN6 — CID 111659019
1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-2-methyl-3-[2-(3-methylphenyl)propyl]guanidine;hydroiodide (PubChem CID 111659019) has the molecular formula C18H27IN6 and a molecular weight of 454.36 g/mol. Its IUPAC name is 1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-2-methyl-3-[2-(3-methylphenyl)propyl]guanidine;hydroiodide.
| Compound Name | 1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-2-methyl-3-[2-(3-methylphenyl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111659019 |
| Molecular Formula | C18H27IN6 |
| Molecular Weight | 454.36 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-2-methyl-3-[2-(3-methylphenyl)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1nnc2n1CCC2)NCC(C)c1cccc(C)c1.I |
| InChI | InChI=1S/C18H26N6.HI/c1-13-6-4-7-15(10-13)14(2)11-20-18(19-3)21-12-17-23-22-16-8-5-9-24(16)17;/h4,6-7,10,14H,5,8-9,11-12H2,1-3H3,(H2,19,20,21);1H |
| InChIKey | LFXFVLFQOZVVFM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|