C17H27IN6S — CID 111703050
2-methyl-1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)-3-(2-thiophen-3-ylpropyl)guanidine;hydroiodide (PubChem CID 111703050) has the molecular formula C17H27IN6S and a molecular weight of 474.42 g/mol. Its IUPAC name is 2-methyl-1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)-3-(2-thiophen-3-ylpropyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)-3-(2-thiophen-3-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111703050 |
| Molecular Formula | C17H27IN6S |
| Molecular Weight | 474.42 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | 2-methyl-1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)-3-(2-thiophen-3-ylpropyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1nnc2n1CCCCC2)NCC(C)c1ccsc1.I |
| InChI | InChI=1S/C17H26N6S.HI/c1-13(14-7-9-24-12-14)10-19-17(18-2)20-11-16-22-21-15-6-4-3-5-8-23(15)16;/h7,9,12-13H,3-6,8,10-11H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | HDHPBOKODSPTSU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|