C19H28N4O4S — CID 111660429
1-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-3-ethyl-2-[(4-sulfamoylphenyl)methyl]guanidine (PubChem CID 111660429) has the molecular formula C19H28N4O4S and a molecular weight of 408.52 g/mol. Its IUPAC name is 1-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-3-ethyl-2-[(4-sulfamoylphenyl)methyl]guanidine.
| Compound Name | 1-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-3-ethyl-2-[(4-sulfamoylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111660429 |
| Molecular Formula | C19H28N4O4S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 1-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-3-ethyl-2-[(4-sulfamoylphenyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(S(N)(=O)=O)cc1)NCC(C)(O)c1cc(C)oc1C |
| InChI | InChI=1S/C19H28N4O4S/c1-5-21-18(22-11-15-6-8-16(9-7-15)28(20,25)26)23-12-19(4,24)17-10-13(2)27-14(17)3/h6-10,24H,5,11-12H2,1-4H3,(H2,20,25,26)(H2,21,22,23) |
| InChIKey | QFCDMCXIKIJTIC-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 129.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|