C24H39IN4O3 — CID 111660650
2-[[4-[3-(dimethylamino)propoxy]phenyl]methyl]-1-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-3-ethylguanidine;hydroiodide (PubChem CID 111660650) has the molecular formula C24H39IN4O3 and a molecular weight of 558.51 g/mol. Its IUPAC name is 2-[[4-[3-(dimethylamino)propoxy]phenyl]methyl]-1-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 2-[[4-[3-(dimethylamino)propoxy]phenyl]methyl]-1-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111660650 |
| Molecular Formula | C24H39IN4O3 |
| Molecular Weight | 558.51 g/mol |
| Exact Mass | 558.21 |
| IUPAC Name | 2-[[4-[3-(dimethylamino)propoxy]phenyl]methyl]-1-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OCCCN(C)C)cc1)NCC(C)(O)c1cc(C)oc1C.I |
| InChI | InChI=1S/C24H38N4O3.HI/c1-7-25-23(27-17-24(4,29)22-15-18(2)31-19(22)3)26-16-20-9-11-21(12-10-20)30-14-8-13-28(5)6;/h9-12,15,29H,7-8,13-14,16-17H2,1-6H3,(H2,25,26,27);1H |
| InChIKey | MESSQDUGOXPUJR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.51 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|