C22H34IN3O5 — CID 111660826
1-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-3-ethyl-2-[(2,4,6-trimethoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111660826) has the molecular formula C22H34IN3O5 and a molecular weight of 547.43 g/mol. Its IUPAC name is 1-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-3-ethyl-2-[(2,4,6-trimethoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-3-ethyl-2-[(2,4,6-trimethoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111660826 |
| Molecular Formula | C22H34IN3O5 |
| Molecular Weight | 547.43 g/mol |
| Exact Mass | 547.15 |
| IUPAC Name | 1-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-3-ethyl-2-[(2,4,6-trimethoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1c(OC)cc(OC)cc1OC)NCC(C)(O)c1cc(C)oc1C.I |
| InChI | InChI=1S/C22H33N3O5.HI/c1-8-23-21(25-13-22(4,26)18-9-14(2)30-15(18)3)24-12-17-19(28-6)10-16(27-5)11-20(17)29-7;/h9-11,26H,8,12-13H2,1-7H3,(H2,23,24,25);1H |
| InChIKey | KASZPUKKVRGTBE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 97.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|