C23H32IN3O4 — CID 111661868
1-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-3-ethyl-2-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111661868) has the molecular formula C23H32IN3O4 and a molecular weight of 541.43 g/mol. Its IUPAC name is 1-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-3-ethyl-2-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-3-ethyl-2-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111661868 |
| Molecular Formula | C23H32IN3O4 |
| Molecular Weight | 541.43 g/mol |
| Exact Mass | 541.14 |
| IUPAC Name | 1-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-3-ethyl-2-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | C#CCOc1cc(C/N=C(\NCC)NCC(C)(O)c2cc(C)oc2C)ccc1OC.I |
| InChI | InChI=1S/C23H31N3O4.HI/c1-7-11-29-21-13-18(9-10-20(21)28-6)14-25-22(24-8-2)26-15-23(5,27)19-12-16(3)30-17(19)4;/h1,9-10,12-13,27H,8,11,14-15H2,2-6H3,(H2,24,25,26);1H |
| InChIKey | QXLWROKUBGCVPJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|