C16H25N3O4 — CID 111662414
2-amino-N-[2-(2-hydroxyethyl)-4-methylpentyl]-5-methyl-3-nitrobenzamide (PubChem CID 111662414) has the molecular formula C16H25N3O4 and a molecular weight of 323.39 g/mol. Its IUPAC name is 2-amino-N-[2-(2-hydroxyethyl)-4-methylpentyl]-5-methyl-3-nitrobenzamide.
| Compound Name | 2-amino-N-[2-(2-hydroxyethyl)-4-methylpentyl]-5-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 111662414 |
| Molecular Formula | C16H25N3O4 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | 2-amino-N-[2-(2-hydroxyethyl)-4-methylpentyl]-5-methyl-3-nitrobenzamide |
| SMILES | Cc1cc(C(=O)NCC(CCO)CC(C)C)c(N)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H25N3O4/c1-10(2)6-12(4-5-20)9-18-16(21)13-7-11(3)8-14(15(13)17)19(22)23/h7-8,10,12,20H,4-6,9,17H2,1-3H3,(H,18,21) |
| InChIKey | XMIVHPULPYUUIZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 118.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|