C13H19ClN2O3 — CID 111663052
5-chloro-6-ethoxy-N-(2-hydroxy-2-methylpropyl)-N-methylpyridine-3-carboxamide (PubChem CID 111663052) has the molecular formula C13H19ClN2O3 and a molecular weight of 286.76 g/mol. Its IUPAC name is 5-chloro-6-ethoxy-N-(2-hydroxy-2-methylpropyl)-N-methylpyridine-3-carboxamide.
| Compound Name | 5-chloro-6-ethoxy-N-(2-hydroxy-2-methylpropyl)-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 111663052 |
| Molecular Formula | C13H19ClN2O3 |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 5-chloro-6-ethoxy-N-(2-hydroxy-2-methylpropyl)-N-methylpyridine-3-carboxamide |
| SMILES | CCOc1ncc(C(=O)N(C)CC(C)(C)O)cc1Cl |
| InChI | InChI=1S/C13H19ClN2O3/c1-5-19-11-10(14)6-9(7-15-11)12(17)16(4)8-13(2,3)18/h6-7,18H,5,8H2,1-4H3 |
| InChIKey | MYIPRVTYBDYGSW-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |