C20H28F3N5O2 — CID 111663477
1-ethyl-2-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]-3-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]guanidine (PubChem CID 111663477) has the molecular formula C20H28F3N5O2 and a molecular weight of 427.47 g/mol. Its IUPAC name is 1-ethyl-2-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]-3-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]guanidine.
| Compound Name | 1-ethyl-2-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]-3-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]guanidine |
|---|---|
| PubChem CID | 111663477 |
| Molecular Formula | C20H28F3N5O2 |
| Molecular Weight | 427.47 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | 1-ethyl-2-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]-3-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]guanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1ccc(C)o1)NCCCNc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C20H28F3N5O2/c1-4-24-18(28-13-19(3,29)16-8-6-14(2)30-16)26-11-5-10-25-17-9-7-15(12-27-17)20(21,22)23/h6-9,12,29H,4-5,10-11,13H2,1-3H3,(H,25,27)(H2,24,26,28) |
| InChIKey | LVFCKEQFJWQQAZ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 94.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|