C18H32N4O2 — CID 111663581
1-[2-[cyclopropyl(methyl)amino]propyl]-3-ethyl-2-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]guanidine (PubChem CID 111663581) has the molecular formula C18H32N4O2 and a molecular weight of 336.48 g/mol. Its IUPAC name is 1-[2-[cyclopropyl(methyl)amino]propyl]-3-ethyl-2-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]guanidine.
| Compound Name | 1-[2-[cyclopropyl(methyl)amino]propyl]-3-ethyl-2-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111663581 |
| Molecular Formula | C18H32N4O2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | 1-[2-[cyclopropyl(methyl)amino]propyl]-3-ethyl-2-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]guanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1ccc(C)o1)NCC(C)N(C)C1CC1 |
| InChI | InChI=1S/C18H32N4O2/c1-6-19-17(20-11-13(2)22(5)15-8-9-15)21-12-18(4,23)16-10-7-14(3)24-16/h7,10,13,15,23H,6,8-9,11-12H2,1-5H3,(H2,19,20,21) |
| InChIKey | KWMIEXJKAUNDST-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 73.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|