C25H38IN3O4 — CID 111664631
1-[[4-(4-ethoxyphenyl)oxan-4-yl]methyl]-3-ethyl-2-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]guanidine;hydroiodide (PubChem CID 111664631) has the molecular formula C25H38IN3O4 and a molecular weight of 571.50 g/mol. Its IUPAC name is 1-[[4-(4-ethoxyphenyl)oxan-4-yl]methyl]-3-ethyl-2-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-[[4-(4-ethoxyphenyl)oxan-4-yl]methyl]-3-ethyl-2-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111664631 |
| Molecular Formula | C25H38IN3O4 |
| Molecular Weight | 571.50 g/mol |
| Exact Mass | 571.19 |
| IUPAC Name | 1-[[4-(4-ethoxyphenyl)oxan-4-yl]methyl]-3-ethyl-2-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)c1ccc(C)o1)NCC1(c2ccc(OCC)cc2)CCOCC1.I |
| InChI | InChI=1S/C25H37N3O4.HI/c1-5-26-23(27-17-24(4,29)22-12-7-19(3)32-22)28-18-25(13-15-30-16-14-25)20-8-10-21(11-9-20)31-6-2;/h7-12,29H,5-6,13-18H2,1-4H3,(H2,26,27,28);1H |
| InChIKey | OISHIKNRWXHKLO-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|