C19H33IN4O — CID 111664989
1-ethyl-2-[(1-ethylpyrrolidin-2-yl)methyl]-3-(3-hydroxy-3-phenylpropyl)guanidine;hydroiodide (PubChem CID 111664989) has the molecular formula C19H33IN4O and a molecular weight of 460.40 g/mol. Its IUPAC name is 1-ethyl-2-[(1-ethylpyrrolidin-2-yl)methyl]-3-(3-hydroxy-3-phenylpropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(1-ethylpyrrolidin-2-yl)methyl]-3-(3-hydroxy-3-phenylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111664989 |
| Molecular Formula | C19H33IN4O |
| Molecular Weight | 460.40 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 1-ethyl-2-[(1-ethylpyrrolidin-2-yl)methyl]-3-(3-hydroxy-3-phenylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1CCCN1CC)NCCC(O)c1ccccc1.I |
| InChI | InChI=1S/C19H32N4O.HI/c1-3-20-19(22-15-17-11-8-14-23(17)4-2)21-13-12-18(24)16-9-6-5-7-10-16;/h5-7,9-10,17-18,24H,3-4,8,11-15H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | MPJNPXKMMFSKBU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|