C27H21N5O2 — CID 11166764
N-[5-cyano-2-[[(4-cyanophenyl)-(3-methylimidazol-4-yl)methoxy]methyl]phenyl]benzamide (PubChem CID 11166764) has the molecular formula C27H21N5O2 and a molecular weight of 447.50 g/mol. Its IUPAC name is N-[5-cyano-2-[[(4-cyanophenyl)-(3-methylimidazol-4-yl)methoxy]methyl]phenyl]benzamide.
| Compound Name | N-[5-cyano-2-[[(4-cyanophenyl)-(3-methylimidazol-4-yl)methoxy]methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 11166764 |
| Molecular Formula | C27H21N5O2 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | N-[5-cyano-2-[[(4-cyanophenyl)-(3-methylimidazol-4-yl)methoxy]methyl]phenyl]benzamide |
| SMILES | Cn1cncc1C(OCc1ccc(C#N)cc1NC(=O)c1ccccc1)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C27H21N5O2/c1-32-18-30-16-25(32)26(21-10-7-19(14-28)8-11-21)34-17-23-12-9-20(15-29)13-24(23)31-27(33)22-5-3-2-4-6-22/h2-13,16,18,26H,17H2,1H3,(H,31,33) |
| InChIKey | XXEJXGJRAHZBLT-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |