C26H31N5O2 — CID 111668622
N,N-dimethyl-3-[2-[[N'-methyl-N-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]carbamimidoyl]amino]ethyl]benzamide (PubChem CID 111668622) has the molecular formula C26H31N5O2 and a molecular weight of 445.57 g/mol. Its IUPAC name is N,N-dimethyl-3-[2-[[N'-methyl-N-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]carbamimidoyl]amino]ethyl]benzamide.
| Compound Name | N,N-dimethyl-3-[2-[[N'-methyl-N-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]carbamimidoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 111668622 |
| Molecular Formula | C26H31N5O2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | N,N-dimethyl-3-[2-[[N'-methyl-N-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]carbamimidoyl]amino]ethyl]benzamide |
| SMILES | C/N=C(/NCCc1cccc(C(=O)N(C)C)c1)NCc1ccc(Cn2ccccc2=O)cc1 |
| InChI | InChI=1S/C26H31N5O2/c1-27-26(28-15-14-20-7-6-8-23(17-20)25(33)30(2)3)29-18-21-10-12-22(13-11-21)19-31-16-5-4-9-24(31)32/h4-13,16-17H,14-15,18-19H2,1-3H3,(H2,27,28,29) |
| InChIKey | TUZUBZMDWCBART-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 78.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|