C27H39N5O — CID 111669588
N,N-dimethyl-3-[2-[[N'-methyl-N-[[4-[(4-methylpiperidin-1-yl)methyl]phenyl]methyl]carbamimidoyl]amino]ethyl]benzamide (PubChem CID 111669588) has the molecular formula C27H39N5O and a molecular weight of 449.64 g/mol. Its IUPAC name is N,N-dimethyl-3-[2-[[N'-methyl-N-[[4-[(4-methylpiperidin-1-yl)methyl]phenyl]methyl]carbamimidoyl]amino]ethyl]benzamide.
| Compound Name | N,N-dimethyl-3-[2-[[N'-methyl-N-[[4-[(4-methylpiperidin-1-yl)methyl]phenyl]methyl]carbamimidoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 111669588 |
| Molecular Formula | C27H39N5O |
| Molecular Weight | 449.64 g/mol |
| Exact Mass | 449.32 |
| IUPAC Name | N,N-dimethyl-3-[2-[[N'-methyl-N-[[4-[(4-methylpiperidin-1-yl)methyl]phenyl]methyl]carbamimidoyl]amino]ethyl]benzamide |
| SMILES | C/N=C(/NCCc1cccc(C(=O)N(C)C)c1)NCc1ccc(CN2CCC(C)CC2)cc1 |
| InChI | InChI=1S/C27H39N5O/c1-21-13-16-32(17-14-21)20-24-10-8-23(9-11-24)19-30-27(28-2)29-15-12-22-6-5-7-25(18-22)26(33)31(3)4/h5-11,18,21H,12-17,19-20H2,1-4H3,(H2,28,29,30) |
| InChIKey | PIKICIGECOPVPS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.64 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|