C25H31IN4O2 — CID 111670093
N,N-dimethyl-3-[2-[[N'-methyl-N-(2-naphthalen-1-yloxyethyl)carbamimidoyl]amino]ethyl]benzamide;hydroiodide (PubChem CID 111670093) has the molecular formula C25H31IN4O2 and a molecular weight of 546.45 g/mol. Its IUPAC name is N,N-dimethyl-3-[2-[[N'-methyl-N-(2-naphthalen-1-yloxyethyl)carbamimidoyl]amino]ethyl]benzamide;hydroiodide.
| Compound Name | N,N-dimethyl-3-[2-[[N'-methyl-N-(2-naphthalen-1-yloxyethyl)carbamimidoyl]amino]ethyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111670093 |
| Molecular Formula | C25H31IN4O2 |
| Molecular Weight | 546.45 g/mol |
| Exact Mass | 546.15 |
| IUPAC Name | N,N-dimethyl-3-[2-[[N'-methyl-N-(2-naphthalen-1-yloxyethyl)carbamimidoyl]amino]ethyl]benzamide;hydroiodide |
| SMILES | C/N=C(/NCCOc1cccc2ccccc12)NCCc1cccc(C(=O)N(C)C)c1.I |
| InChI | InChI=1S/C25H30N4O2.HI/c1-26-25(27-15-14-19-8-6-11-21(18-19)24(30)29(2)3)28-16-17-31-23-13-7-10-20-9-4-5-12-22(20)23;/h4-13,18H,14-17H2,1-3H3,(H2,26,27,28);1H |
| InChIKey | WYLZMBBNOJKSOW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|