C20H29N5OS — CID 111670832
N,N-dimethyl-3-[2-[[N'-methyl-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]carbamimidoyl]amino]ethyl]benzamide (PubChem CID 111670832) has the molecular formula C20H29N5OS and a molecular weight of 387.55 g/mol. Its IUPAC name is N,N-dimethyl-3-[2-[[N'-methyl-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]carbamimidoyl]amino]ethyl]benzamide.
| Compound Name | N,N-dimethyl-3-[2-[[N'-methyl-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]carbamimidoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 111670832 |
| Molecular Formula | C20H29N5OS |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | N,N-dimethyl-3-[2-[[N'-methyl-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]carbamimidoyl]amino]ethyl]benzamide |
| SMILES | C/N=C(\NCCCc1nc(C)cs1)NCCc1cccc(C(=O)N(C)C)c1 |
| InChI | InChI=1S/C20H29N5OS/c1-15-14-27-18(24-15)9-6-11-22-20(21-2)23-12-10-16-7-5-8-17(13-16)19(26)25(3)4/h5,7-8,13-14H,6,9-12H2,1-4H3,(H2,21,22,23) |
| InChIKey | MRGHWGYCHXNXEC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|