C20H36N4O3 — CID 111672110
1-ethyl-2-[2-(furan-2-yl)-2-hydroxypropyl]-3-(4-methyl-2-morpholin-4-ylpentyl)guanidine (PubChem CID 111672110) has the molecular formula C20H36N4O3 and a molecular weight of 380.53 g/mol. Its IUPAC name is 1-ethyl-2-[2-(furan-2-yl)-2-hydroxypropyl]-3-(4-methyl-2-morpholin-4-ylpentyl)guanidine.
| Compound Name | 1-ethyl-2-[2-(furan-2-yl)-2-hydroxypropyl]-3-(4-methyl-2-morpholin-4-ylpentyl)guanidine |
|---|---|
| PubChem CID | 111672110 |
| Molecular Formula | C20H36N4O3 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.28 |
| IUPAC Name | 1-ethyl-2-[2-(furan-2-yl)-2-hydroxypropyl]-3-(4-methyl-2-morpholin-4-ylpentyl)guanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1ccco1)NCC(CC(C)C)N1CCOCC1 |
| InChI | InChI=1S/C20H36N4O3/c1-5-21-19(23-15-20(4,25)18-7-6-10-27-18)22-14-17(13-16(2)3)24-8-11-26-12-9-24/h6-7,10,16-17,25H,5,8-9,11-15H2,1-4H3,(H2,21,22,23) |
| InChIKey | IBNAJPWDXYPZFE-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|