C19H35N5O2 — CID 111672986
1-ethyl-3-[2-(4-ethylpiperazin-1-yl)propyl]-2-[2-(furan-2-yl)-2-hydroxypropyl]guanidine (PubChem CID 111672986) has the molecular formula C19H35N5O2 and a molecular weight of 365.52 g/mol. Its IUPAC name is 1-ethyl-3-[2-(4-ethylpiperazin-1-yl)propyl]-2-[2-(furan-2-yl)-2-hydroxypropyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(4-ethylpiperazin-1-yl)propyl]-2-[2-(furan-2-yl)-2-hydroxypropyl]guanidine |
|---|---|
| PubChem CID | 111672986 |
| Molecular Formula | C19H35N5O2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.28 |
| IUPAC Name | 1-ethyl-3-[2-(4-ethylpiperazin-1-yl)propyl]-2-[2-(furan-2-yl)-2-hydroxypropyl]guanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1ccco1)NCC(C)N1CCN(CC)CC1 |
| InChI | InChI=1S/C19H35N5O2/c1-5-20-18(22-15-19(4,25)17-8-7-13-26-17)21-14-16(3)24-11-9-23(6-2)10-12-24/h7-8,13,16,25H,5-6,9-12,14-15H2,1-4H3,(H2,20,21,22) |
| InChIKey | CXIBKLARAAERCC-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 76.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|