C22H33N5O3 — CID 111672486
2-[[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-1-ethyl-3-[2-(furan-2-yl)-2-hydroxypropyl]guanidine (PubChem CID 111672486) has the molecular formula C22H33N5O3 and a molecular weight of 415.54 g/mol. Its IUPAC name is 2-[[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-1-ethyl-3-[2-(furan-2-yl)-2-hydroxypropyl]guanidine.
| Compound Name | 2-[[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-1-ethyl-3-[2-(furan-2-yl)-2-hydroxypropyl]guanidine |
|---|---|
| PubChem CID | 111672486 |
| Molecular Formula | C22H33N5O3 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.26 |
| IUPAC Name | 2-[[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-1-ethyl-3-[2-(furan-2-yl)-2-hydroxypropyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(N2CC(C)OC(C)C2)nc1)NCC(C)(O)c1ccco1 |
| InChI | InChI=1S/C22H33N5O3/c1-5-23-21(26-15-22(4,28)19-7-6-10-29-19)25-12-18-8-9-20(24-11-18)27-13-16(2)30-17(3)14-27/h6-11,16-17,28H,5,12-15H2,1-4H3,(H2,23,25,26) |
| InChIKey | JDZRKCLYPCCSSN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 95.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|