C14H17F4NO3 — CID 111672685
1-[5-fluoro-2-hydroxy-3-[[3-hydroxypropyl(2,2,2-trifluoroethyl)amino]methyl]phenyl]ethanone (PubChem CID 111672685) has the molecular formula C14H17F4NO3 and a molecular weight of 323.29 g/mol. Its IUPAC name is 1-[5-fluoro-2-hydroxy-3-[[3-hydroxypropyl(2,2,2-trifluoroethyl)amino]methyl]phenyl]ethanone.
| Compound Name | 1-[5-fluoro-2-hydroxy-3-[[3-hydroxypropyl(2,2,2-trifluoroethyl)amino]methyl]phenyl]ethanone |
|---|---|
| PubChem CID | 111672685 |
| Molecular Formula | C14H17F4NO3 |
| Molecular Weight | 323.29 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 1-[5-fluoro-2-hydroxy-3-[[3-hydroxypropyl(2,2,2-trifluoroethyl)amino]methyl]phenyl]ethanone |
| SMILES | CC(=O)c1cc(F)cc(CN(CCCO)CC(F)(F)F)c1O |
| InChI | InChI=1S/C14H17F4NO3/c1-9(21)12-6-11(15)5-10(13(12)22)7-19(3-2-4-20)8-14(16,17)18/h5-6,20,22H,2-4,7-8H2,1H3 |
| InChIKey | FEMGZWGADJJLQI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|