C21H25ClF2N2O2 — CID 45263833
(E)-1-[3,5-bis[(dimethylamino)methyl]-4-hydroxyphenyl]-3-(2,5-difluorophenyl)prop-2-en-1-one;hydrochloride (PubChem CID 45263833) has the molecular formula C21H25ClF2N2O2 and a molecular weight of 410.89 g/mol. Its IUPAC name is (E)-1-[3,5-bis[(dimethylamino)methyl]-4-hydroxyphenyl]-3-(2,5-difluorophenyl)prop-2-en-1-one;hydrochloride.
| Compound Name | (E)-1-[3,5-bis[(dimethylamino)methyl]-4-hydroxyphenyl]-3-(2,5-difluorophenyl)prop-2-en-1-one;hydrochloride |
|---|---|
| PubChem CID | 45263833 |
| Molecular Formula | C21H25ClF2N2O2 |
| Molecular Weight | 410.89 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | (E)-1-[3,5-bis[(dimethylamino)methyl]-4-hydroxyphenyl]-3-(2,5-difluorophenyl)prop-2-en-1-one;hydrochloride |
| SMILES | CN(C)Cc1cc(C(=O)/C=C/c2cc(F)ccc2F)cc(CN(C)C)c1O.Cl |
| InChI | InChI=1S/C21H24F2N2O2.ClH/c1-24(2)12-16-9-15(10-17(21(16)27)13-25(3)4)20(26)8-5-14-11-18(22)6-7-19(14)23;/h5-11,27H,12-13H2,1-4H3;1H/b8-5+; |
| InChIKey | IZTDWAKDANEWLX-HAAWTFQLSA-N |
| XLogP | 4.11 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.89 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|