C18H21NO3 — CID 5001490
1-[3-[(dimethylamino)methyl]-2,4-dihydroxyphenyl]-2-(2-methylphenyl)ethanone (PubChem CID 5001490) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is 1-[3-[(dimethylamino)methyl]-2,4-dihydroxyphenyl]-2-(2-methylphenyl)ethanone.
| Compound Name | 1-[3-[(dimethylamino)methyl]-2,4-dihydroxyphenyl]-2-(2-methylphenyl)ethanone |
|---|---|
| PubChem CID | 5001490 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 1-[3-[(dimethylamino)methyl]-2,4-dihydroxyphenyl]-2-(2-methylphenyl)ethanone |
| SMILES | Cc1ccccc1CC(=O)c1ccc(O)c(CN(C)C)c1O |
| InChI | InChI=1S/C18H21NO3/c1-12-6-4-5-7-13(12)10-17(21)14-8-9-16(20)15(18(14)22)11-19(2)3/h4-9,20,22H,10-11H2,1-3H3 |
| InChIKey | MKJMLBQFHLEAFH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|