C23H35IN4S — CID 111673965
2-methyl-1-(2-methyl-3-thiophen-2-ylpropyl)-3-[[1-(2-phenylethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide (PubChem CID 111673965) has the molecular formula C23H35IN4S and a molecular weight of 526.53 g/mol. Its IUPAC name is 2-methyl-1-(2-methyl-3-thiophen-2-ylpropyl)-3-[[1-(2-phenylethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(2-methyl-3-thiophen-2-ylpropyl)-3-[[1-(2-phenylethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111673965 |
| Molecular Formula | C23H35IN4S |
| Molecular Weight | 526.53 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | 2-methyl-1-(2-methyl-3-thiophen-2-ylpropyl)-3-[[1-(2-phenylethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCC(C)Cc1cccs1)NCC1CCN(CCc2ccccc2)C1.I |
| InChI | InChI=1S/C23H34N4S.HI/c1-19(15-22-9-6-14-28-22)16-25-23(24-2)26-17-21-11-13-27(18-21)12-10-20-7-4-3-5-8-20;/h3-9,14,19,21H,10-13,15-18H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | LINDXDZPXFBVEA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.53 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|