C22H36IN5O2 — CID 111675561
1-[[3-[2-(dimethylamino)ethoxy]phenyl]methyl]-2-methyl-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide (PubChem CID 111675561) has the molecular formula C22H36IN5O2 and a molecular weight of 529.47 g/mol. Its IUPAC name is 1-[[3-[2-(dimethylamino)ethoxy]phenyl]methyl]-2-methyl-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[[3-[2-(dimethylamino)ethoxy]phenyl]methyl]-2-methyl-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111675561 |
| Molecular Formula | C22H36IN5O2 |
| Molecular Weight | 529.47 g/mol |
| Exact Mass | 529.19 |
| IUPAC Name | 1-[[3-[2-(dimethylamino)ethoxy]phenyl]methyl]-2-methyl-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide |
| SMILES | CCC(CC)c1cc(CN/C(=N\C)NCc2cccc(OCCN(C)C)c2)on1.I |
| InChI | InChI=1S/C22H35N5O2.HI/c1-6-18(7-2)21-14-20(29-26-21)16-25-22(23-3)24-15-17-9-8-10-19(13-17)28-12-11-27(4)5;/h8-10,13-14,18H,6-7,11-12,15-16H2,1-5H3,(H2,23,24,25);1H |
| InChIKey | KIRUBBCPMIZYFE-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 74.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|