C21H32N4O3 — CID 109461428
1-[3-(3-methoxypropoxy)phenyl]-2-methyl-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine (PubChem CID 109461428) has the molecular formula C21H32N4O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is 1-[3-(3-methoxypropoxy)phenyl]-2-methyl-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine.
| Compound Name | 1-[3-(3-methoxypropoxy)phenyl]-2-methyl-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109461428 |
| Molecular Formula | C21H32N4O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | 1-[3-(3-methoxypropoxy)phenyl]-2-methyl-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine |
| SMILES | CCC(CC)c1cc(CN/C(=N\C)Nc2cccc(OCCCOC)c2)on1 |
| InChI | InChI=1S/C21H32N4O3/c1-5-16(6-2)20-14-19(28-25-20)15-23-21(22-3)24-17-9-7-10-18(13-17)27-12-8-11-26-4/h7,9-10,13-14,16H,5-6,8,11-12,15H2,1-4H3,(H2,22,23,24) |
| InChIKey | MREIXBOTLJIALR-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|