C26H33IN6O — CID 111676245
1-[[4-(benzimidazol-1-ylmethyl)phenyl]methyl]-2-methyl-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide (PubChem CID 111676245) has the molecular formula C26H33IN6O and a molecular weight of 572.50 g/mol. Its IUPAC name is 1-[[4-(benzimidazol-1-ylmethyl)phenyl]methyl]-2-methyl-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[[4-(benzimidazol-1-ylmethyl)phenyl]methyl]-2-methyl-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111676245 |
| Molecular Formula | C26H33IN6O |
| Molecular Weight | 572.50 g/mol |
| Exact Mass | 572.18 |
| IUPAC Name | 1-[[4-(benzimidazol-1-ylmethyl)phenyl]methyl]-2-methyl-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide |
| SMILES | CCC(CC)c1cc(CN/C(=N\C)NCc2ccc(Cn3cnc4ccccc43)cc2)on1.I |
| InChI | InChI=1S/C26H32N6O.HI/c1-4-21(5-2)24-14-22(33-31-24)16-29-26(27-3)28-15-19-10-12-20(13-11-19)17-32-18-30-23-8-6-7-9-25(23)32;/h6-14,18,21H,4-5,15-17H2,1-3H3,(H2,27,28,29);1H |
| InChIKey | IJCKBUSJULDBKK-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 80.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.50 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|