C21H27FIN5O — CID 111677727
1-[3-(1H-benzimidazol-2-yl)propyl]-3-[2-(4-fluorophenoxy)propyl]-2-methylguanidine;hydroiodide (PubChem CID 111677727) has the molecular formula C21H27FIN5O and a molecular weight of 511.38 g/mol. Its IUPAC name is 1-[3-(1H-benzimidazol-2-yl)propyl]-3-[2-(4-fluorophenoxy)propyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[3-(1H-benzimidazol-2-yl)propyl]-3-[2-(4-fluorophenoxy)propyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111677727 |
| Molecular Formula | C21H27FIN5O |
| Molecular Weight | 511.38 g/mol |
| Exact Mass | 511.12 |
| IUPAC Name | 1-[3-(1H-benzimidazol-2-yl)propyl]-3-[2-(4-fluorophenoxy)propyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCCc1nc2ccccc2[nH]1)NCC(C)Oc1ccc(F)cc1.I |
| InChI | InChI=1S/C21H26FN5O.HI/c1-15(28-17-11-9-16(22)10-12-17)14-25-21(23-2)24-13-5-8-20-26-18-6-3-4-7-19(18)27-20;/h3-4,6-7,9-12,15H,5,8,13-14H2,1-2H3,(H,26,27)(H2,23,24,25);1H |
| InChIKey | JJVMTRTYNXQDEF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|