C20H25FIN5 — CID 111395626
1-[3-(1H-benzimidazol-2-yl)propyl]-3-[2-(3-fluorophenyl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111395626) has the molecular formula C20H25FIN5 and a molecular weight of 481.36 g/mol. Its IUPAC name is 1-[3-(1H-benzimidazol-2-yl)propyl]-3-[2-(3-fluorophenyl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[3-(1H-benzimidazol-2-yl)propyl]-3-[2-(3-fluorophenyl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111395626 |
| Molecular Formula | C20H25FIN5 |
| Molecular Weight | 481.36 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | 1-[3-(1H-benzimidazol-2-yl)propyl]-3-[2-(3-fluorophenyl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCCc1nc2ccccc2[nH]1)NCCc1cccc(F)c1.I |
| InChI | InChI=1S/C20H24FN5.HI/c1-22-20(24-13-11-15-6-4-7-16(21)14-15)23-12-5-10-19-25-17-8-2-3-9-18(17)26-19;/h2-4,6-9,14H,5,10-13H2,1H3,(H,25,26)(H2,22,23,24);1H |
| InChIKey | DQJBEMPRAHJZJG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.36 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|