C22H26FN5 — CID 111638390
1-[3-(1H-benzimidazol-2-yl)propyl]-3-[[1-(3-fluorophenyl)cyclopropyl]methyl]-2-methylguanidine (PubChem CID 111638390) has the molecular formula C22H26FN5 and a molecular weight of 379.48 g/mol. Its IUPAC name is 1-[3-(1H-benzimidazol-2-yl)propyl]-3-[[1-(3-fluorophenyl)cyclopropyl]methyl]-2-methylguanidine.
| Compound Name | 1-[3-(1H-benzimidazol-2-yl)propyl]-3-[[1-(3-fluorophenyl)cyclopropyl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111638390 |
| Molecular Formula | C22H26FN5 |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.22 |
| IUPAC Name | 1-[3-(1H-benzimidazol-2-yl)propyl]-3-[[1-(3-fluorophenyl)cyclopropyl]methyl]-2-methylguanidine |
| SMILES | C/N=C(/NCCCc1nc2ccccc2[nH]1)NCC1(c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C22H26FN5/c1-24-21(26-15-22(11-12-22)16-6-4-7-17(23)14-16)25-13-5-10-20-27-18-8-2-3-9-19(18)28-20/h2-4,6-9,14H,5,10-13,15H2,1H3,(H,27,28)(H2,24,25,26) |
| InChIKey | FOSBFNGQQHUHEL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|