C28H31NO5S — CID 11167816
(4S)-3-[(1R)-1-(benzenesulfonyl)-5-phenylmethoxypentyl]-4-benzyl-1,3-oxazolidin-2-one (PubChem CID 11167816) has the molecular formula C28H31NO5S and a molecular weight of 493.63 g/mol. Its IUPAC name is (4S)-3-[(1R)-1-(benzenesulfonyl)-5-phenylmethoxypentyl]-4-benzyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(1R)-1-(benzenesulfonyl)-5-phenylmethoxypentyl]-4-benzyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11167816 |
| Molecular Formula | C28H31NO5S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | (4S)-3-[(1R)-1-(benzenesulfonyl)-5-phenylmethoxypentyl]-4-benzyl-1,3-oxazolidin-2-one |
| SMILES | O=C1OC[C@H](Cc2ccccc2)N1[C@@H](CCCCOCc1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C28H31NO5S/c30-28-29(25(22-34-28)20-23-12-4-1-5-13-23)27(35(31,32)26-16-8-3-9-17-26)18-10-11-19-33-21-24-14-6-2-7-15-24/h1-9,12-17,25,27H,10-11,18-22H2/t25-,27+/m0/s1 |
| InChIKey | RBOISPTUTYRDLH-AHKZPQOWSA-N |
| XLogP | 5.24 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|