C18H22ClFN4O — CID 111678324
2-[(6-chloro-3-pyridinyl)methyl]-1-ethyl-3-[2-(4-fluorophenoxy)propyl]guanidine (PubChem CID 111678324) has the molecular formula C18H22ClFN4O and a molecular weight of 364.85 g/mol. Its IUPAC name is 2-[(6-chloro-3-pyridinyl)methyl]-1-ethyl-3-[2-(4-fluorophenoxy)propyl]guanidine.
| Compound Name | 2-[(6-chloro-3-pyridinyl)methyl]-1-ethyl-3-[2-(4-fluorophenoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111678324 |
| Molecular Formula | C18H22ClFN4O |
| Molecular Weight | 364.85 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 2-[(6-chloro-3-pyridinyl)methyl]-1-ethyl-3-[2-(4-fluorophenoxy)propyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(Cl)nc1)NCC(C)Oc1ccc(F)cc1 |
| InChI | InChI=1S/C18H22ClFN4O/c1-3-21-18(24-12-14-4-9-17(19)22-11-14)23-10-13(2)25-16-7-5-15(20)6-8-16/h4-9,11,13H,3,10,12H2,1-2H3,(H2,21,23,24) |
| InChIKey | RUAQTHPNOUCGOS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.85 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|