C17H25FN4O2 — CID 111678470
N-cyclopropyl-2-[[ethylamino-[2-(4-fluorophenoxy)propylamino]methylidene]amino]acetamide (PubChem CID 111678470) has the molecular formula C17H25FN4O2 and a molecular weight of 336.41 g/mol. Its IUPAC name is N-cyclopropyl-2-[[ethylamino-[2-(4-fluorophenoxy)propylamino]methylidene]amino]acetamide.
| Compound Name | N-cyclopropyl-2-[[ethylamino-[2-(4-fluorophenoxy)propylamino]methylidene]amino]acetamide |
|---|---|
| PubChem CID | 111678470 |
| Molecular Formula | C17H25FN4O2 |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | N-cyclopropyl-2-[[ethylamino-[2-(4-fluorophenoxy)propylamino]methylidene]amino]acetamide |
| SMILES | CCN/C(=N\CC(=O)NC1CC1)NCC(C)Oc1ccc(F)cc1 |
| InChI | InChI=1S/C17H25FN4O2/c1-3-19-17(21-11-16(23)22-14-6-7-14)20-10-12(2)24-15-8-4-13(18)5-9-15/h4-5,8-9,12,14H,3,6-7,10-11H2,1-2H3,(H,22,23)(H2,19,20,21) |
| InChIKey | CTGUAOAWCODYIS-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|