C17H27FN4O2 — CID 111678856
2-[[ethylamino-[2-(4-fluorophenoxy)propylamino]methylidene]amino]-N-propylacetamide (PubChem CID 111678856) has the molecular formula C17H27FN4O2 and a molecular weight of 338.43 g/mol. Its IUPAC name is 2-[[ethylamino-[2-(4-fluorophenoxy)propylamino]methylidene]amino]-N-propylacetamide.
| Compound Name | 2-[[ethylamino-[2-(4-fluorophenoxy)propylamino]methylidene]amino]-N-propylacetamide |
|---|---|
| PubChem CID | 111678856 |
| Molecular Formula | C17H27FN4O2 |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 2-[[ethylamino-[2-(4-fluorophenoxy)propylamino]methylidene]amino]-N-propylacetamide |
| SMILES | CCCNC(=O)C/N=C(\NCC)NCC(C)Oc1ccc(F)cc1 |
| InChI | InChI=1S/C17H27FN4O2/c1-4-10-20-16(23)12-22-17(19-5-2)21-11-13(3)24-15-8-6-14(18)7-9-15/h6-9,13H,4-5,10-12H2,1-3H3,(H,20,23)(H2,19,21,22) |
| InChIKey | HZHKJRGRQGHENY-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|