C18H31IN4O2 — CID 111686147
2-[[ethylamino-[2-(3-methylphenoxy)propylamino]methylidene]amino]-N-propylacetamide;hydroiodide (PubChem CID 111686147) has the molecular formula C18H31IN4O2 and a molecular weight of 462.38 g/mol. Its IUPAC name is 2-[[ethylamino-[2-(3-methylphenoxy)propylamino]methylidene]amino]-N-propylacetamide;hydroiodide.
| Compound Name | 2-[[ethylamino-[2-(3-methylphenoxy)propylamino]methylidene]amino]-N-propylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111686147 |
| Molecular Formula | C18H31IN4O2 |
| Molecular Weight | 462.38 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 2-[[ethylamino-[2-(3-methylphenoxy)propylamino]methylidene]amino]-N-propylacetamide;hydroiodide |
| SMILES | CCCNC(=O)C/N=C(\NCC)NCC(C)Oc1cccc(C)c1.I |
| InChI | InChI=1S/C18H30N4O2.HI/c1-5-10-20-17(23)13-22-18(19-6-2)21-12-15(4)24-16-9-7-8-14(3)11-16;/h7-9,11,15H,5-6,10,12-13H2,1-4H3,(H,20,23)(H2,19,21,22);1H |
| InChIKey | IGIMXZZNZNAAMB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|