C18H27N5O — CID 111685944
1-ethyl-3-[2-(3-methylphenoxy)propyl]-2-[(2-methylpyrazol-3-yl)methyl]guanidine (PubChem CID 111685944) has the molecular formula C18H27N5O and a molecular weight of 329.45 g/mol. Its IUPAC name is 1-ethyl-3-[2-(3-methylphenoxy)propyl]-2-[(2-methylpyrazol-3-yl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(3-methylphenoxy)propyl]-2-[(2-methylpyrazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111685944 |
| Molecular Formula | C18H27N5O |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | 1-ethyl-3-[2-(3-methylphenoxy)propyl]-2-[(2-methylpyrazol-3-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccnn1C)NCC(C)Oc1cccc(C)c1 |
| InChI | InChI=1S/C18H27N5O/c1-5-19-18(21-13-16-9-10-22-23(16)4)20-12-15(3)24-17-8-6-7-14(2)11-17/h6-11,15H,5,12-13H2,1-4H3,(H2,19,20,21) |
| InChIKey | NCXNPYPVHFWTMY-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|