C19H26F3N5O — CID 109464652
1-ethyl-2-[(2-methylpyrazol-3-yl)methyl]-3-[2-[3-(trifluoromethyl)phenoxy]butyl]guanidine (PubChem CID 109464652) has the molecular formula C19H26F3N5O and a molecular weight of 397.45 g/mol. Its IUPAC name is 1-ethyl-2-[(2-methylpyrazol-3-yl)methyl]-3-[2-[3-(trifluoromethyl)phenoxy]butyl]guanidine.
| Compound Name | 1-ethyl-2-[(2-methylpyrazol-3-yl)methyl]-3-[2-[3-(trifluoromethyl)phenoxy]butyl]guanidine |
|---|---|
| PubChem CID | 109464652 |
| Molecular Formula | C19H26F3N5O |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | 1-ethyl-2-[(2-methylpyrazol-3-yl)methyl]-3-[2-[3-(trifluoromethyl)phenoxy]butyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccnn1C)NCC(CC)Oc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H26F3N5O/c1-4-16(28-17-8-6-7-14(11-17)19(20,21)22)13-25-18(23-5-2)24-12-15-9-10-26-27(15)3/h6-11,16H,4-5,12-13H2,1-3H3,(H2,23,24,25) |
| InChIKey | MWAAETSZCXHRJU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|