C20H28F3N5O — CID 109464648
2-methyl-1-[3-(1-methylpyrazol-4-yl)propyl]-3-[2-[3-(trifluoromethyl)phenoxy]butyl]guanidine (PubChem CID 109464648) has the molecular formula C20H28F3N5O and a molecular weight of 411.47 g/mol. Its IUPAC name is 2-methyl-1-[3-(1-methylpyrazol-4-yl)propyl]-3-[2-[3-(trifluoromethyl)phenoxy]butyl]guanidine.
| Compound Name | 2-methyl-1-[3-(1-methylpyrazol-4-yl)propyl]-3-[2-[3-(trifluoromethyl)phenoxy]butyl]guanidine |
|---|---|
| PubChem CID | 109464648 |
| Molecular Formula | C20H28F3N5O |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 2-methyl-1-[3-(1-methylpyrazol-4-yl)propyl]-3-[2-[3-(trifluoromethyl)phenoxy]butyl]guanidine |
| SMILES | CCC(CN/C(=N/C)NCCCc1cnn(C)c1)Oc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H28F3N5O/c1-4-17(29-18-9-5-8-16(11-18)20(21,22)23)13-26-19(24-2)25-10-6-7-15-12-27-28(3)14-15/h5,8-9,11-12,14,17H,4,6-7,10,13H2,1-3H3,(H2,24,25,26) |
| InChIKey | ICQBUMYLRCKWGK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|