C21H31F3N6O — CID 109464606
1-[2-(dimethylamino)-2-(1-methylpyrazol-4-yl)ethyl]-2-methyl-3-[2-[3-(trifluoromethyl)phenoxy]butyl]guanidine (PubChem CID 109464606) has the molecular formula C21H31F3N6O and a molecular weight of 440.51 g/mol. Its IUPAC name is 1-[2-(dimethylamino)-2-(1-methylpyrazol-4-yl)ethyl]-2-methyl-3-[2-[3-(trifluoromethyl)phenoxy]butyl]guanidine.
| Compound Name | 1-[2-(dimethylamino)-2-(1-methylpyrazol-4-yl)ethyl]-2-methyl-3-[2-[3-(trifluoromethyl)phenoxy]butyl]guanidine |
|---|---|
| PubChem CID | 109464606 |
| Molecular Formula | C21H31F3N6O |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | 1-[2-(dimethylamino)-2-(1-methylpyrazol-4-yl)ethyl]-2-methyl-3-[2-[3-(trifluoromethyl)phenoxy]butyl]guanidine |
| SMILES | CCC(CN/C(=N/C)NCC(c1cnn(C)c1)N(C)C)Oc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H31F3N6O/c1-6-17(31-18-9-7-8-16(10-18)21(22,23)24)12-26-20(25-2)27-13-19(29(3)4)15-11-28-30(5)14-15/h7-11,14,17,19H,6,12-13H2,1-5H3,(H2,25,26,27) |
| InChIKey | RSQLJLSZNWKJPL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|