C21H29F3N6O — CID 111954269
1-ethyl-2-[(2-methylpyrazol-3-yl)methyl]-3-[2-morpholin-4-yl-2-[4-(trifluoromethyl)phenyl]ethyl]guanidine (PubChem CID 111954269) has the molecular formula C21H29F3N6O and a molecular weight of 438.50 g/mol. Its IUPAC name is 1-ethyl-2-[(2-methylpyrazol-3-yl)methyl]-3-[2-morpholin-4-yl-2-[4-(trifluoromethyl)phenyl]ethyl]guanidine.
| Compound Name | 1-ethyl-2-[(2-methylpyrazol-3-yl)methyl]-3-[2-morpholin-4-yl-2-[4-(trifluoromethyl)phenyl]ethyl]guanidine |
|---|---|
| PubChem CID | 111954269 |
| Molecular Formula | C21H29F3N6O |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | 1-ethyl-2-[(2-methylpyrazol-3-yl)methyl]-3-[2-morpholin-4-yl-2-[4-(trifluoromethyl)phenyl]ethyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccnn1C)NCC(c1ccc(C(F)(F)F)cc1)N1CCOCC1 |
| InChI | InChI=1S/C21H29F3N6O/c1-3-25-20(26-14-18-8-9-28-29(18)2)27-15-19(30-10-12-31-13-11-30)16-4-6-17(7-5-16)21(22,23)24/h4-9,19H,3,10-15H2,1-2H3,(H2,25,26,27) |
| InChIKey | KOVYWHYCNVYFRQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|