C19H27F3N4O — CID 110981737
1-ethyl-2-[2-morpholin-4-yl-2-[4-(trifluoromethyl)phenyl]ethyl]-3-prop-2-enylguanidine (PubChem CID 110981737) has the molecular formula C19H27F3N4O and a molecular weight of 384.45 g/mol. Its IUPAC name is 1-ethyl-2-[2-morpholin-4-yl-2-[4-(trifluoromethyl)phenyl]ethyl]-3-prop-2-enylguanidine.
| Compound Name | 1-ethyl-2-[2-morpholin-4-yl-2-[4-(trifluoromethyl)phenyl]ethyl]-3-prop-2-enylguanidine |
|---|---|
| PubChem CID | 110981737 |
| Molecular Formula | C19H27F3N4O |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | 1-ethyl-2-[2-morpholin-4-yl-2-[4-(trifluoromethyl)phenyl]ethyl]-3-prop-2-enylguanidine |
| SMILES | C=CCN/C(=N/CC(c1ccc(C(F)(F)F)cc1)N1CCOCC1)NCC |
| InChI | InChI=1S/C19H27F3N4O/c1-3-9-24-18(23-4-2)25-14-17(26-10-12-27-13-11-26)15-5-7-16(8-6-15)19(20,21)22/h3,5-8,17H,1,4,9-14H2,2H3,(H2,23,24,25) |
| InChIKey | SUWVYEVHDMPGMW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|