C20H28N4O3 — CID 111679374
1-[(2-ethoxy-3-pyridinyl)methyl]-3-[2-(3-methoxyphenoxy)propyl]-2-methylguanidine (PubChem CID 111679374) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is 1-[(2-ethoxy-3-pyridinyl)methyl]-3-[2-(3-methoxyphenoxy)propyl]-2-methylguanidine.
| Compound Name | 1-[(2-ethoxy-3-pyridinyl)methyl]-3-[2-(3-methoxyphenoxy)propyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111679374 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | 1-[(2-ethoxy-3-pyridinyl)methyl]-3-[2-(3-methoxyphenoxy)propyl]-2-methylguanidine |
| SMILES | CCOc1ncccc1CN/C(=N/C)NCC(C)Oc1cccc(OC)c1 |
| InChI | InChI=1S/C20H28N4O3/c1-5-26-19-16(8-7-11-22-19)14-24-20(21-3)23-13-15(2)27-18-10-6-9-17(12-18)25-4/h6-12,15H,5,13-14H2,1-4H3,(H2,21,23,24) |
| InChIKey | LDCNFYZZOODAMB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|