C19H22F4N4O2 — CID 111678596
1-[2-(4-fluorophenoxy)propyl]-2-methyl-3-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine (PubChem CID 111678596) has the molecular formula C19H22F4N4O2 and a molecular weight of 414.40 g/mol. Its IUPAC name is 1-[2-(4-fluorophenoxy)propyl]-2-methyl-3-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine.
| Compound Name | 1-[2-(4-fluorophenoxy)propyl]-2-methyl-3-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111678596 |
| Molecular Formula | C19H22F4N4O2 |
| Molecular Weight | 414.40 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 1-[2-(4-fluorophenoxy)propyl]-2-methyl-3-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine |
| SMILES | C/N=C(/NCc1cccnc1OCC(F)(F)F)NCC(C)Oc1ccc(F)cc1 |
| InChI | InChI=1S/C19H22F4N4O2/c1-13(29-16-7-5-15(20)6-8-16)10-26-18(24-2)27-11-14-4-3-9-25-17(14)28-12-19(21,22)23/h3-9,13H,10-12H2,1-2H3,(H2,24,26,27) |
| InChIKey | LCUWSUCQKPCPPB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|