C16H22FIN4OS — CID 111681181
1-[2-(3-fluorophenoxy)propyl]-2-methyl-3-[(2-methyl-1,3-thiazol-5-yl)methyl]guanidine;hydroiodide (PubChem CID 111681181) has the molecular formula C16H22FIN4OS and a molecular weight of 464.35 g/mol. Its IUPAC name is 1-[2-(3-fluorophenoxy)propyl]-2-methyl-3-[(2-methyl-1,3-thiazol-5-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3-fluorophenoxy)propyl]-2-methyl-3-[(2-methyl-1,3-thiazol-5-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111681181 |
| Molecular Formula | C16H22FIN4OS |
| Molecular Weight | 464.35 g/mol |
| Exact Mass | 464.05 |
| IUPAC Name | 1-[2-(3-fluorophenoxy)propyl]-2-methyl-3-[(2-methyl-1,3-thiazol-5-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cnc(C)s1)NCC(C)Oc1cccc(F)c1.I |
| InChI | InChI=1S/C16H21FN4OS.HI/c1-11(22-14-6-4-5-13(17)7-14)8-20-16(18-3)21-10-15-9-19-12(2)23-15;/h4-7,9,11H,8,10H2,1-3H3,(H2,18,20,21);1H |
| InChIKey | RSQCKRRQADURPJ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|