C20H27FN4O3S — CID 111681602
1-ethyl-3-[2-(3-fluorophenoxy)propyl]-2-[[3-(methylsulfamoyl)phenyl]methyl]guanidine (PubChem CID 111681602) has the molecular formula C20H27FN4O3S and a molecular weight of 422.53 g/mol. Its IUPAC name is 1-ethyl-3-[2-(3-fluorophenoxy)propyl]-2-[[3-(methylsulfamoyl)phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(3-fluorophenoxy)propyl]-2-[[3-(methylsulfamoyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111681602 |
| Molecular Formula | C20H27FN4O3S |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 1-ethyl-3-[2-(3-fluorophenoxy)propyl]-2-[[3-(methylsulfamoyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(S(=O)(=O)NC)c1)NCC(C)Oc1cccc(F)c1 |
| InChI | InChI=1S/C20H27FN4O3S/c1-4-23-20(24-13-15(2)28-18-9-6-8-17(21)12-18)25-14-16-7-5-10-19(11-16)29(26,27)22-3/h5-12,15,22H,4,13-14H2,1-3H3,(H2,23,24,25) |
| InChIKey | AMVCZWMRTIRPDS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|