C20H26FN3O4 — CID 111681572
methyl 5-[[[ethylamino-[2-(3-fluorophenoxy)propylamino]methylidene]amino]methyl]-2-methylfuran-3-carboxylate (PubChem CID 111681572) has the molecular formula C20H26FN3O4 and a molecular weight of 391.44 g/mol. Its IUPAC name is methyl 5-[[[ethylamino-[2-(3-fluorophenoxy)propylamino]methylidene]amino]methyl]-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-[[[ethylamino-[2-(3-fluorophenoxy)propylamino]methylidene]amino]methyl]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 111681572 |
| Molecular Formula | C20H26FN3O4 |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | methyl 5-[[[ethylamino-[2-(3-fluorophenoxy)propylamino]methylidene]amino]methyl]-2-methylfuran-3-carboxylate |
| SMILES | CCN/C(=N\Cc1cc(C(=O)OC)c(C)o1)NCC(C)Oc1cccc(F)c1 |
| InChI | InChI=1S/C20H26FN3O4/c1-5-22-20(23-11-13(2)27-16-8-6-7-15(21)9-16)24-12-17-10-18(14(3)28-17)19(25)26-4/h6-10,13H,5,11-12H2,1-4H3,(H2,22,23,24) |
| InChIKey | DVRIXCWAMUYKFX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|