C21H30IN3O5 — CID 111682953
methyl 5-[[[ethylamino-[2-(2-methoxyphenoxy)propylamino]methylidene]amino]methyl]-2-methylfuran-3-carboxylate;hydroiodide (PubChem CID 111682953) has the molecular formula C21H30IN3O5 and a molecular weight of 531.39 g/mol. Its IUPAC name is methyl 5-[[[ethylamino-[2-(2-methoxyphenoxy)propylamino]methylidene]amino]methyl]-2-methylfuran-3-carboxylate;hydroiodide.
| Compound Name | methyl 5-[[[ethylamino-[2-(2-methoxyphenoxy)propylamino]methylidene]amino]methyl]-2-methylfuran-3-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111682953 |
| Molecular Formula | C21H30IN3O5 |
| Molecular Weight | 531.39 g/mol |
| Exact Mass | 531.12 |
| IUPAC Name | methyl 5-[[[ethylamino-[2-(2-methoxyphenoxy)propylamino]methylidene]amino]methyl]-2-methylfuran-3-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(C(=O)OC)c(C)o1)NCC(C)Oc1ccccc1OC.I |
| InChI | InChI=1S/C21H29N3O5.HI/c1-6-22-21(24-13-16-11-17(15(3)29-16)20(25)27-5)23-12-14(2)28-19-10-8-7-9-18(19)26-4;/h7-11,14H,6,12-13H2,1-5H3,(H2,22,23,24);1H |
| InChIKey | JZLJLFXHMGABIO-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|