C22H32IN3O4 — CID 111640671
methyl 5-[[[ethylamino-[3-(4-methoxyphenyl)butylamino]methylidene]amino]methyl]-2-methylfuran-3-carboxylate;hydroiodide (PubChem CID 111640671) has the molecular formula C22H32IN3O4 and a molecular weight of 529.42 g/mol. Its IUPAC name is methyl 5-[[[ethylamino-[3-(4-methoxyphenyl)butylamino]methylidene]amino]methyl]-2-methylfuran-3-carboxylate;hydroiodide.
| Compound Name | methyl 5-[[[ethylamino-[3-(4-methoxyphenyl)butylamino]methylidene]amino]methyl]-2-methylfuran-3-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111640671 |
| Molecular Formula | C22H32IN3O4 |
| Molecular Weight | 529.42 g/mol |
| Exact Mass | 529.14 |
| IUPAC Name | methyl 5-[[[ethylamino-[3-(4-methoxyphenyl)butylamino]methylidene]amino]methyl]-2-methylfuran-3-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(C(=O)OC)c(C)o1)NCCC(C)c1ccc(OC)cc1.I |
| InChI | InChI=1S/C22H31N3O4.HI/c1-6-23-22(25-14-19-13-20(16(3)29-19)21(26)28-5)24-12-11-15(2)17-7-9-18(27-4)10-8-17;/h7-10,13,15H,6,11-12,14H2,1-5H3,(H2,23,24,25);1H |
| InChIKey | RQCKIVSDIJYRNO-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|